n-(1-cyano-cyclopentyl)-benzamide structure
|
Common Name | n-(1-cyano-cyclopentyl)-benzamide | ||
|---|---|---|---|---|
| CAS Number | 91806-24-5 | Molecular Weight | 214.26300 | |
| Density | 1.15g/cm3 | Boiling Point | 462.1ºC at 760 mmHg | |
| Molecular Formula | C13H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.3ºC | |
| Name | n-(1-cyano-cyclopentyl)-benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 462.1ºC at 760 mmHg |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.26300 |
| Flash Point | 233.3ºC |
| Exact Mass | 214.11100 |
| PSA | 52.89000 |
| LogP | 2.64368 |
| Index of Refraction | 1.57 |
| InChIKey | ZWPJTMIVMQPYNO-UHFFFAOYSA-N |
| SMILES | N#CC1(NC(=O)c2ccccc2)CCCC1 |
| HS Code | 2926909090 |
|---|
|
~%
n-(1-cyano-cycl... CAS#:91806-24-5 |
| Literature: Sudo,R.; Ichihara,S. Bulletin of the Chemical Society of Japan, 1963 , vol. 36, p. 34 - 37 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-Benzoylamino-cyclopentylnitril |
| Benzamide,N-(2,3-dihydro-2-oxo-5-phenyl-1H-imidazol-1-yl) |
| 1-benzoylamino-5-phenyl-2-imidazolone |