2-ethyl-1H-benzo[f]benzimidazole-4,9-dione structure
|
Common Name | 2-ethyl-1H-benzo[f]benzimidazole-4,9-dione | ||
|---|---|---|---|---|
| CAS Number | 91822-69-4 | Molecular Weight | 226.23100 | |
| Density | 1.384g/cm3 | Boiling Point | 521.2ºC at 760 mmHg | |
| Molecular Formula | C13H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.5ºC | |
| Name | 2-ethyl-1H-benzo[f]benzimidazole-4,9-dione |
|---|
| Density | 1.384g/cm3 |
|---|---|
| Boiling Point | 521.2ºC at 760 mmHg |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.23100 |
| Flash Point | 263.5ºC |
| Exact Mass | 226.07400 |
| PSA | 62.82000 |
| LogP | 1.74750 |
| Index of Refraction | 1.665 |
| InChIKey | BDRALAFPLKRVJQ-UHFFFAOYSA-N |
| SMILES | CCc1nc2c([nH]1)C(=O)c1ccccc1C2=O |
|
~%
2-ethyl-1H-benz... CAS#:91822-69-4 |
| Literature: Hoover; Day Journal of the American Chemical Society, 1954 , vol. 76, p. 4148,4151 |
|
~%
2-ethyl-1H-benz... CAS#:91822-69-4 |
| Literature: Hoover; Day Journal of the American Chemical Society, 1954 , vol. 76, p. 4148,4151 |
|
~%
2-ethyl-1H-benz... CAS#:91822-69-4 |
| Literature: Hoover; Day Journal of the American Chemical Society, 1954 , vol. 76, p. 4148,4151 |
|
~%
2-ethyl-1H-benz... CAS#:91822-69-4 |
| Literature: Hoover; Day Journal of the American Chemical Society, 1954 , vol. 76, p. 4148,4151 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |