5-bromo-3-ethyl-7-iodo-1H-indole
5-bromo-3-ethyl-7-iodo-1H-indole structure
|
Common Name | 5-bromo-3-ethyl-7-iodo-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 918446-43-2 | Molecular Weight | 349.99400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9BrIN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 5-Bromo-3-ethyl-7-iodo-1H-indole (Chinese name: 5-溴-3-乙基-7-碘吲哚), CAS number: 918446-43-2, molecular formula: C10H9BrIN, molecular weight: 349.99400, for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-bromo-3-ethyl-7-iodo-1H-indole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9BrIN |
|---|---|
| Molecular Weight | 349.99400 |
| Exact Mass | 348.89600 |
| PSA | 15.79000 |
| LogP | 4.09740 |
| InChIKey | QVMIOTZGSWPLLD-UHFFFAOYSA-N |
| SMILES | CCc1c[nH]c2c(I)cc(Br)cc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~69%
5-bromo-3-ethyl... CAS#:918446-43-2 |
| Literature: Charrier, Nicolas; Demont, Emmanuel; Dunsdon, Rachel; Maile, Graham; Naylor, Alan; O'Brien, Alistair; Redshaw, Sally; Theobald, Pam; Vesey, David; Walter, Daryl Synthesis, 2006 , # 20 p. 3467 - 3477 |
|
~%
5-bromo-3-ethyl... CAS#:918446-43-2 |
| Literature: Charrier, Nicolas; Demont, Emmanuel; Dunsdon, Rachel; Maile, Graham; Naylor, Alan; O'Brien, Alistair; Redshaw, Sally; Theobald, Pam; Vesey, David; Walter, Daryl Synthesis, 2006 , # 20 p. 3467 - 3477 |
|
~%
5-bromo-3-ethyl... CAS#:918446-43-2 |
| Literature: Charrier, Nicolas; Demont, Emmanuel; Dunsdon, Rachel; Maile, Graham; Naylor, Alan; O'Brien, Alistair; Redshaw, Sally; Theobald, Pam; Vesey, David; Walter, Daryl Synthesis, 2006 , # 20 p. 3467 - 3477 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1H-Indole,5-bromo-3-ethyl-7-iodo |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-bromo-3-ethyl-7-iodo-1H-indole? |
| A: InChIKey of 5-bromo-3-ethyl-7-iodo-1H-indole is QVMIOTZGSWPLLD-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 918446-43-2? |
| A: Chinese name of 918446-43-2 is 918446-43-2. |
| Q: What English synonyms does 5-bromo-3-ethyl-7-iodo-1H-indole have? |
| A: English synonyms of 5-bromo-3-ethyl-7-iodo-1H-indole: 1H-Indole,5-bromo-3-ethyl-7-iodo. |
| Q: What is the polar surface area (PSA) of 5-bromo-3-ethyl-7-iodo-1H-indole? |
| A: Polar surface area (PSA) of 5-bromo-3-ethyl-7-iodo-1H-indole is 15.79000. |
| Q: What is the molecular formula of 5-bromo-3-ethyl-7-iodo-1H-indole? |
| A: Molecular formula of 5-bromo-3-ethyl-7-iodo-1H-indole is C10H9BrIN. |
| Q: What is the CAS number of 5-bromo-3-ethyl-7-iodo-1H-indole? |
| A: CAS number of 5-bromo-3-ethyl-7-iodo-1H-indole is 918446-43-2. |
| Q: What is the LogP of 5-bromo-3-ethyl-7-iodo-1H-indole? |
| A: LogP of 5-bromo-3-ethyl-7-iodo-1H-indole is 4.09740. |
| Q: What is the SMILES notation of 5-bromo-3-ethyl-7-iodo-1H-indole? |
| A: SMILES notation of 5-bromo-3-ethyl-7-iodo-1H-indole is CCc1c[nH]c2c(I)cc(Br)cc12. |
| Q: What is the molecular weight of 5-bromo-3-ethyl-7-iodo-1H-indole? |
| A: Molecular weight of 5-bromo-3-ethyl-7-iodo-1H-indole is 349.99400. |
| Q: What is the English name of 5-bromo-3-ethyl-7-iodo-1H-indole? |
| A: The English name of 5-bromo-3-ethyl-7-iodo-1H-indole is 5-bromo-3-ethyl-7-iodo-1H-indole. |