2-[2-hydroxyethyl-(7-methyl-2-propyl-1,8-naphthyridin-4-yl)amino]ethanol structure
|
Common Name | 2-[2-hydroxyethyl-(7-methyl-2-propyl-1,8-naphthyridin-4-yl)amino]ethanol | ||
|---|---|---|---|---|
| CAS Number | 91860-05-8 | Molecular Weight | 289.37300 | |
| Density | 1.197g/cm3 | Boiling Point | 470.9ºC at 760 mmHg | |
| Molecular Formula | C16H23N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.6ºC | |
| Name | 2-[2-hydroxyethyl-(7-methyl-2-propyl-1,8-naphthyridin-4-yl)amino]ethanol |
|---|
| Density | 1.197g/cm3 |
|---|---|
| Boiling Point | 470.9ºC at 760 mmHg |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.37300 |
| Flash Point | 238.6ºC |
| Exact Mass | 289.17900 |
| PSA | 69.48000 |
| LogP | 1.68170 |
| Index of Refraction | 1.629 |
| InChIKey | XGLKXPGOEJGYDK-UHFFFAOYSA-N |
| SMILES | CCCc1cc(N(CCO)CCO)c2ccc(C)nc2n1 |
|
~40%
2-[2-hydroxyeth... CAS#:91860-05-8 |
| Literature: Ferrarini; Mori; Biagi; et al. Journal of Heterocyclic Chemistry, 1984 , vol. 21, # 2 p. 417 - 419 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |