Ethanol,2,2'-[(5,7-dimethyl-1,8-naphthyridin-2-yl)imino]bis- structure
|
Common Name | Ethanol,2,2'-[(5,7-dimethyl-1,8-naphthyridin-2-yl)imino]bis- | ||
|---|---|---|---|---|
| CAS Number | 91860-11-6 | Molecular Weight | 261.32000 | |
| Density | 1.252g/cm3 | Boiling Point | 485.1ºC at 760mmHg | |
| Molecular Formula | C14H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.2ºC | |
| Name | 2-[(5,7-dimethyl-1,8-naphthyridin-2-yl)-(2-hydroxyethyl)amino]ethanol |
|---|
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 485.1ºC at 760mmHg |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32000 |
| Flash Point | 247.2ºC |
| Exact Mass | 261.14800 |
| PSA | 69.48000 |
| LogP | 1.03760 |
| Index of Refraction | 1.655 |
| InChIKey | ODHZPRLNTDJPSS-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c2ccc(N(CCO)CCO)nc2n1 |
|
~70%
Ethanol,2,2'-[(... CAS#:91860-11-6 |
| Literature: Ferrarini; Mori; Biagi; et al. Journal of Heterocyclic Chemistry, 1984 , vol. 21, # 2 p. 417 - 419 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |