Ethanol,2,2',2'',2'''-(1,8-naphthyridine-2,7-diyldinitrilo)tetrakis- (9CI) structure
|
Common Name | Ethanol,2,2',2'',2'''-(1,8-naphthyridine-2,7-diyldinitrilo)tetrakis- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 91860-12-7 | Molecular Weight | 336.38600 | |
| Density | 1.389g/cm3 | Boiling Point | 646.4ºC at 760mmHg | |
| Molecular Formula | C16H24N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 344.7ºC | |
| Name | 2-[[7-[bis(2-hydroxyethyl)amino]-1,8-naphthyridin-2-yl]-(2-hydroxyethyl)amino]ethanol |
|---|
| Density | 1.389g/cm3 |
|---|---|
| Boiling Point | 646.4ºC at 760mmHg |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.38600 |
| Flash Point | 344.7ºC |
| Exact Mass | 336.18000 |
| PSA | 113.18000 |
| Index of Refraction | 1.7 |
| InChIKey | OJGLUOQQOPUTRI-UHFFFAOYSA-N |
| SMILES | OCCN(CCO)c1ccc2ccc(N(CCO)CCO)nc2n1 |
|
~83%
Ethanol,2,2',2'... CAS#:91860-12-7 |
| Literature: Ferrarini; Mori; Biagi; et al. Journal of Heterocyclic Chemistry, 1984 , vol. 21, # 2 p. 417 - 419 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |