7-(bis(2-hydroxyethyl)amino)-1-methyl-1,8-naphthyridin-2-one structure
|
Common Name | 7-(bis(2-hydroxyethyl)amino)-1-methyl-1,8-naphthyridin-2-one | ||
|---|---|---|---|---|
| CAS Number | 91860-14-9 | Molecular Weight | 263.29200 | |
| Density | 1.34g/cm3 | Boiling Point | 511.1ºC at 760 mmHg | |
| Molecular Formula | C13H17N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.9ºC | |
| Name | 7-[bis(2-hydroxyethyl)amino]-1-methyl-1,8-naphthyridin-2-one |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 511.1ºC at 760 mmHg |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.29200 |
| Flash Point | 262.9ºC |
| Exact Mass | 263.12700 |
| PSA | 78.59000 |
| Index of Refraction | 1.644 |
| InChIKey | LORZJRJCRJUGST-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)ccc2ccc(N(CCO)CCO)nc21 |
|
~83%
7-(bis(2-hydrox... CAS#:91860-14-9 |
| Literature: Ferrarini; Mori; Biagi; et al. Journal of Heterocyclic Chemistry, 1984 , vol. 21, # 2 p. 417 - 419 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |