N,N-bis(2-chloroethyl)-7-methyl-2-phenyl-1,8-naphthyridin-4-amine structure
|
Common Name | N,N-bis(2-chloroethyl)-7-methyl-2-phenyl-1,8-naphthyridin-4-amine | ||
|---|---|---|---|---|
| CAS Number | 91860-18-3 | Molecular Weight | 360.28000 | |
| Density | 1.262g/cm3 | Boiling Point | 513.4ºC at 760 mmHg | |
| Molecular Formula | C19H19Cl2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.3ºC | |
| Name | N,N-bis(2-chloroethyl)-7-methyl-2-phenyl-1,8-naphthyridin-4-amine |
|---|
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 513.4ºC at 760 mmHg |
| Molecular Formula | C19H19Cl2N3 |
| Molecular Weight | 360.28000 |
| Flash Point | 264.3ºC |
| Exact Mass | 359.09600 |
| PSA | 29.02000 |
| LogP | 4.88920 |
| Index of Refraction | 1.641 |
| InChIKey | CSOWKJWYGFQORN-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(N(CCCl)CCCl)cc(-c3ccccc3)nc2n1 |
|
~73%
N,N-bis(2-chlor... CAS#:91860-18-3 |
| Literature: Ferrarini; Mori; Biagi; et al. Journal of Heterocyclic Chemistry, 1984 , vol. 21, # 2 p. 417 - 419 |
|
~%
N,N-bis(2-chlor... CAS#:91860-18-3 |
| Literature: Ferrarini; Mori; Biagi; et al. Journal of Heterocyclic Chemistry, 1984 , vol. 21, # 2 p. 417 - 419 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |