Phenol,2,4-bis(1,1-dimethylethyl)-6-[(4-methoxyphenyl)(2-pyrimidinylamino)methyl]- structure
|
Common Name | Phenol,2,4-bis(1,1-dimethylethyl)-6-[(4-methoxyphenyl)(2-pyrimidinylamino)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 91860-24-1 | Molecular Weight | 419.55900 | |
| Density | 1.116g/cm3 | Boiling Point | 546.8ºC at 760mmHg | |
| Molecular Formula | C26H33N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.5ºC | |
| Name | 2,4-ditert-butyl-6-[(4-methoxyphenyl)-(pyrimidin-2-ylamino)methyl]phenol |
|---|
| Density | 1.116g/cm3 |
|---|---|
| Boiling Point | 546.8ºC at 760mmHg |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.55900 |
| Flash Point | 284.5ºC |
| Exact Mass | 419.25700 |
| PSA | 67.27000 |
| LogP | 6.06030 |
| Index of Refraction | 1.587 |
| InChIKey | QVDAQPKLZXWJAR-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(Nc2ncccn2)c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)cc1 |
|
~87%
Phenol,2,4-bis(... CAS#:91860-24-1 |
| Literature: Jurd, Leonard Journal of Heterocyclic Chemistry, 1984 , vol. 21, # 1 p. 81 - 83 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |