3-bromoprop-1-enyl 2,4,6-trimethylbenzoate structure
|
Common Name | 3-bromoprop-1-enyl 2,4,6-trimethylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 918971-09-2 | Molecular Weight | 283.16100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-bromoprop-1-enyl 2,4,6-trimethylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H15BrO2 |
|---|---|
| Molecular Weight | 283.16100 |
| Exact Mass | 282.02600 |
| PSA | 26.30000 |
| LogP | 3.67720 |
| InChIKey | TWSKZKMSFNKSFR-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C(=O)OC=CCBr)c(C)c1 |
|
~%
3-bromoprop-1-e... CAS#:918971-09-2 |
| Literature: Geurts, Koen; Fletcher, Stephen P.; Feringa, Ben L. Journal of the American Chemical Society, 2006 , vol. 128, # 49 p. 15572 - 15573 |
| Benzoic acid,2,4,6-trimethyl-,(1E)-3-bromo-1-propen-1-yl ester |