C3F7-O-Chf-CF2-O-CH2cooh
Modify Date: 2025-09-07 20:24:44
C3F7-O-Chf-CF2-O-CH2cooh structure
|
Common Name | C3F7-O-Chf-CF2-O-CH2cooh | ||
|---|---|---|---|---|
| CAS Number | 919005-33-7 | Molecular Weight | 342.09 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4F10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | C3F7-O-Chf-CF2-O-CH2cooh |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H4F10O4 |
|---|---|
| Molecular Weight | 342.09 |
| InChIKey | PMLRCZDTMRVYDU-UHFFFAOYSA-N |
| SMILES | O=C(O)COC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of C3F7-O-Chf-CF2-O-CH2cooh? |
| A: Molecular weight of C3F7-O-Chf-CF2-O-CH2cooh is 342.09. |
| Q: What is the Chinese name of 919005-33-7? |
| A: Chinese name of 919005-33-7 is 919005-33-7. |
| Q: What is the SMILES notation of C3F7-O-Chf-CF2-O-CH2cooh? |
| A: SMILES notation of C3F7-O-Chf-CF2-O-CH2cooh is O=C(O)COC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F. |
| Q: What is the CAS number of C3F7-O-Chf-CF2-O-CH2cooh? |
| A: CAS number of C3F7-O-Chf-CF2-O-CH2cooh is 919005-33-7. |
| Q: What is the English name of C3F7-O-Chf-CF2-O-CH2cooh? |
| A: The English name of C3F7-O-Chf-CF2-O-CH2cooh is C3F7-O-Chf-CF2-O-CH2cooh. |
| Q: What is the molecular formula of C3F7-O-Chf-CF2-O-CH2cooh? |
| A: Molecular formula of C3F7-O-Chf-CF2-O-CH2cooh is C7H4F10O4. |
| Q: What is the InChIKey of C3F7-O-Chf-CF2-O-CH2cooh? |
| A: InChIKey of C3F7-O-Chf-CF2-O-CH2cooh is PMLRCZDTMRVYDU-UHFFFAOYSA-N. |