2-Naphthalenecarboxylicacid, 3-hydroxy-4-nitro-, ethyl ester structure
|
Common Name | 2-Naphthalenecarboxylicacid, 3-hydroxy-4-nitro-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 91901-71-2 | Molecular Weight | 261.23000 | |
| Density | 1.387g/cm3 | Boiling Point | 374ºC at 760 mmHg | |
| Molecular Formula | C13H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-nitro-2-hydroxy-3-naphthoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.387g/cm3 |
|---|---|
| Boiling Point | 374ºC at 760 mmHg |
| Molecular Formula | C13H11NO5 |
| Molecular Weight | 261.23000 |
| Exact Mass | 261.06400 |
| PSA | 92.35000 |
| LogP | 3.15350 |
| Index of Refraction | 1.653 |
| InChIKey | CNIAAYLKBIGAOG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2ccccc2c([N+](=O)[O-])c1O |
|
~%
2-Naphthaleneca... CAS#:91901-71-2 |
| Literature: Meisenheimer; Theilacker; Beisswenger Justus Liebigs Annalen der Chemie, 1932 , vol. 495, p. 249,275 |
|
~%
2-Naphthaleneca... CAS#:91901-71-2 |
| Literature: Jadhav; Rao Proceedings - Indian Academy of Sciences, Section A, 1946 , vol. 23, p. 335 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2-Naphthoic acid,3-hydroxy-4-nitro |
| 3-hydroxy-4-nitro-[2]naphthoic acid |
| 1-Nitro-2-naphthol-3-carbonsaeure |
| 3-Hydroxy-4-nitro-[2]naphthoesaeure |
| 3-Hydroxy-4-nitro-[2]naphthoesaeure-aethylester |
| 3-hydroxy-4-nitro-[2]naphthoic acid ethyl ester |