5-Benzylsulfanylmethyl-furan-2-carboxylic acid
Modify Date: 2025-08-26 13:51:02
5-Benzylsulfanylmethyl-furan-2-carboxylic acid structure
|
Common Name | 5-Benzylsulfanylmethyl-furan-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 91903-26-3 | Molecular Weight | 248.29800 | |
| Density | 1.291g/cm3 | Boiling Point | 417ºC at 760mmHg | |
| Molecular Formula | C13H12O3S | Melting Point | N/A | |
| MSDS | USA | Flash Point | 206ºC | |
| Name | 5-(benzylsulfanylmethyl)furan-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.291g/cm3 |
|---|---|
| Boiling Point | 417ºC at 760mmHg |
| Molecular Formula | C13H12O3S |
| Molecular Weight | 248.29800 |
| Flash Point | 206ºC |
| Exact Mass | 248.05100 |
| PSA | 75.74000 |
| LogP | 3.41120 |
| Index of Refraction | 1.619 |
| InChIKey | CRBLYLGNCNZCEG-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(CSCc2ccccc2)o1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-Benzylsulfanylmethyl-furan-2-carboxylic acid |