1,5-bis(3-chlorophenyl)-2-methylpenta-1,4-dien-3-one structure
|
Common Name | 1,5-bis(3-chlorophenyl)-2-methylpenta-1,4-dien-3-one | ||
|---|---|---|---|---|
| CAS Number | 919079-80-4 | Molecular Weight | 317.20900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,5-bis(3-chlorophenyl)-2-methylpenta-1,4-dien-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H14Cl2O |
|---|---|
| Molecular Weight | 317.20900 |
| Exact Mass | 316.04200 |
| PSA | 17.07000 |
| LogP | 5.67920 |
| InChIKey | BISQTGDPEBASAK-UHFFFAOYSA-N |
| SMILES | CC(=Cc1cccc(Cl)c1)C(=O)C=Cc1cccc(Cl)c1 |
|
~%
1,5-bis(3-chlor... CAS#:919079-80-4 |
| Literature: Ananthakrishna Nadar; Renuga Journal of the Indian Chemical Society, 2006 , vol. 83, # 12 p. 1219 - 1222 |
| 1,4-Pentadien-3-one,1,5-bis(3-chlorophenyl)-2-methyl |