N,N-DIETHYLINDOLINE-5-SULFONAMIDE structure
|
Common Name | N,N-DIETHYLINDOLINE-5-SULFONAMIDE | ||
|---|---|---|---|---|
| CAS Number | 91908-29-1 | Molecular Weight | 254.34900 | |
| Density | 1.193g/cm3 | Boiling Point | 411ºC at 760mmHg | |
| Molecular Formula | C12H18N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.4ºC | |
| Name | N,N-diethyl-2,3-dihydro-1H-indole-5-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.193g/cm3 |
|---|---|
| Boiling Point | 411ºC at 760mmHg |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.34900 |
| Flash Point | 202.4ºC |
| Exact Mass | 254.10900 |
| PSA | 57.79000 |
| LogP | 2.90390 |
| Index of Refraction | 1.559 |
| InChIKey | LDAUEKPMNUEUGU-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)CCN2 |
| HS Code | 2935009090 |
|---|
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|
Name: qHTS assay for inhibitors of human lactate dehydrogenase
Source: NCGC
Target: N/A
External Id: LDHA
|
|
Name: Primary qHTS Assay for Foot and Mouth Disease Virus Antivirals against NCGC Sytravon ...
Source: NCGC
External Id: stopgo-p2-SytraCBC-dual-FF
|
|
Name: Primary qHTS Assay for Foot and Mouth Disease Virus Antivirals against NCGC Sytravon ...
Source: NCGC
External Id: stopgo-p2-SytraCBC-dual-Ren
|
| 2,3-dihydro-indole-5-sulfonic acid diethylamide |
| Indolin-sulfonsaeure-(5)-diethylamid |
| N,N-diethylindoline-5-sulfonamide |