N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]propanamide
Modify Date: 2026-07-29 10:13:56
![N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]propanamide Structure](https://www.chemsrc.com/extcaspic/147/91908-48-4.png)
N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]propanamide structure
|
Common Name | N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]propanamide | ||
|---|---|---|---|---|
| CAS Number | 91908-48-4 | Molecular Weight | 238.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]propanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H18N2O3 |
|---|---|
| Molecular Weight | 238.28 |
| InChIKey | XOGVPDDNCOIVNA-UHFFFAOYSA-N |
| SMILES | CCC(=O)NC(CO)C(O)c1ccc(N)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]propanamide? |
| A: CAS number of N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]propanamide is 91908-48-4. |
| Q: What is the InChIKey of N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]propanamide? |
| A: InChIKey of N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]propanamide is XOGVPDDNCOIVNA-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 91908-48-4? |
| A: Chinese name of 91908-48-4 is 91908-48-4. |
| Q: What is the SMILES notation of N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]propanamide? |
| A: SMILES notation of N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]propanamide is CCC(=O)NC(CO)C(O)c1ccc(N)cc1. |
| Q: What is the English name of N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]propanamide? |
| A: The English name of N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]propanamide is N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]propanamide. |
| Q: What is the molecular formula of N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]propanamide? |
| A: Molecular formula of N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]propanamide is C12H18N2O3. |
| Q: What is the molecular weight of N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]propanamide? |
| A: Molecular weight of N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]propanamide is 238.28. |