Methyl 5-(dimethylsulfamoyl)-2-[(2-hydroxyethyl)amino]benzoate
Modify Date: 2026-08-21 20:04:11
![Methyl 5-(dimethylsulfamoyl)-2-[(2-hydroxyethyl)amino]benzoate Structure](https://www.chemsrc.com/extcaspic/178/91908-96-2.png)
Methyl 5-(dimethylsulfamoyl)-2-[(2-hydroxyethyl)amino]benzoate structure
|
Common Name | Methyl 5-(dimethylsulfamoyl)-2-[(2-hydroxyethyl)amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 91908-96-2 | Molecular Weight | 302.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 5-(dimethylsulfamoyl)-2-[(2-hydroxyethyl)amino]benzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H18N2O5S |
|---|---|
| Molecular Weight | 302.35 |
| InChIKey | IEIBBIOUIKGPNK-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(S(=O)(=O)N(C)C)ccc1NCCO |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Methyl 5-(dimethylsulfamoyl)-2-[(2-hydroxyethyl)amino]benzoate? |
| A: The English name of Methyl 5-(dimethylsulfamoyl)-2-[(2-hydroxyethyl)amino]benzoate is Methyl 5-(dimethylsulfamoyl)-2-[(2-hydroxyethyl)amino]benzoate. |
| Q: What is the Chinese name of 91908-96-2? |
| A: Chinese name of 91908-96-2 is 91908-96-2. |
| Q: What is the CAS number of Methyl 5-(dimethylsulfamoyl)-2-[(2-hydroxyethyl)amino]benzoate? |
| A: CAS number of Methyl 5-(dimethylsulfamoyl)-2-[(2-hydroxyethyl)amino]benzoate is 91908-96-2. |
| Q: What is the molecular weight of Methyl 5-(dimethylsulfamoyl)-2-[(2-hydroxyethyl)amino]benzoate? |
| A: Molecular weight of Methyl 5-(dimethylsulfamoyl)-2-[(2-hydroxyethyl)amino]benzoate is 302.35. |
| Q: What is the molecular formula of Methyl 5-(dimethylsulfamoyl)-2-[(2-hydroxyethyl)amino]benzoate? |
| A: Molecular formula of Methyl 5-(dimethylsulfamoyl)-2-[(2-hydroxyethyl)amino]benzoate is C12H18N2O5S. |
| Q: What is the InChIKey of Methyl 5-(dimethylsulfamoyl)-2-[(2-hydroxyethyl)amino]benzoate? |
| A: InChIKey of Methyl 5-(dimethylsulfamoyl)-2-[(2-hydroxyethyl)amino]benzoate is IEIBBIOUIKGPNK-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Methyl 5-(dimethylsulfamoyl)-2-[(2-hydroxyethyl)amino]benzoate? |
| A: SMILES notation of Methyl 5-(dimethylsulfamoyl)-2-[(2-hydroxyethyl)amino]benzoate is COC(=O)c1cc(S(=O)(=O)N(C)C)ccc1NCCO. |