3-[2-(2,6-dichlorophenyl)sulfanylanilino]-1-phenylbut-2-en-1-one structure
|
Common Name | 3-[2-(2,6-dichlorophenyl)sulfanylanilino]-1-phenylbut-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 919083-26-4 | Molecular Weight | 414.34700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H17Cl2NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[2-(2,6-dichlorophenyl)sulfanylanilino]-1-phenylbut-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H17Cl2NOS |
|---|---|
| Molecular Weight | 414.34700 |
| Exact Mass | 413.04100 |
| PSA | 54.40000 |
| LogP | 7.41620 |
| InChIKey | TYXYGTFFJSHYNM-UHFFFAOYSA-N |
| SMILES | CC(=CC(=O)c1ccccc1)Nc1ccccc1Sc1c(Cl)cccc1Cl |
|
~73%
3-[2-(2,6-dichl... CAS#:919083-26-4 |
| Literature: SHANGHAI INSTITUTE OF ORGANIC CHEMISTRY, CHINESE ACADEMY OF SCIENCES Patent: EP2039677 A1, 2009 ; Location in patent: Page/Page column 10 ; |
| 2-Buten-1-one,3-[[2-[(2,6-dichlorophenyl)thio]phenyl]amino]-1-phenyl |