4-(2-phenylsulfanylanilino)pent-3-en-2-one structure
|
Common Name | 4-(2-phenylsulfanylanilino)pent-3-en-2-one | ||
|---|---|---|---|---|
| CAS Number | 919083-37-7 | Molecular Weight | 283.38800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2-phenylsulfanylanilino)pent-3-en-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H17NOS |
|---|---|
| Molecular Weight | 283.38800 |
| Exact Mass | 283.10300 |
| PSA | 54.40000 |
| LogP | 4.81550 |
| InChIKey | OCAUVWPCKNRANS-UHFFFAOYSA-N |
| SMILES | CC(=O)C=C(C)Nc1ccccc1Sc1ccccc1 |
|
~52%
4-(2-phenylsulf... CAS#:919083-37-7 |
| Literature: SHANGHAI INSTITUTE OF ORGANIC CHEMISTRY, CHINESE ACADEMY OF SCIENCES Patent: EP2039677 A1, 2009 ; Location in patent: Page/Page column 11 ; |
| 3-Penten-2-one,4-[[2-(phenylthio)phenyl]amino] |