8-methoxy-2,7,9,10-tetrahydro-1H-tricyclo[6.2.2.02,7]dodeca-3,9-diene-3,6-dione structure
|
Common Name | 8-methoxy-2,7,9,10-tetrahydro-1H-tricyclo[6.2.2.02,7]dodeca-3,9-diene-3,6-dione | ||
|---|---|---|---|---|
| CAS Number | 91910-07-5 | Molecular Weight | 218.24800 | |
| Density | 1.23g/cm3 | Boiling Point | 353.9ºC at 760 mmHg | |
| Molecular Formula | C13H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.6ºC | |
| Name | 8-methoxy-2,7,9,10-tetrahydro-1H-tricyclo[6.2.2.02,7]dodeca-3,9-diene-3,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 353.9ºC at 760 mmHg |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.24800 |
| Flash Point | 157.6ºC |
| Exact Mass | 218.09400 |
| PSA | 43.37000 |
| LogP | 1.29180 |
| Index of Refraction | 1.57 |
| InChIKey | JTEWEOMDCJDQCW-UHFFFAOYSA-N |
| SMILES | COC12C=CC(CC1)C1C(=O)C=CC(=O)C12 |
|
~%
8-methoxy-2,7,9... CAS#:91910-07-5 |
| Literature: Hugo; Snijman; Green Synthetic Communications, 1993 , vol. 23, # 5 p. 577 - 584 |
|
~%
8-methoxy-2,7,9... CAS#:91910-07-5 |
| Literature: Birch,A.J. et al. Journal of the Chemical Society, 1964 , p. 2932 - 2941 |
| 1,4-Ethanonaphthalene-5,8-dione,1,4,4a,8a-tetrahydro-1-methoxy |
| ghl.PD_Mitscher_leg0.297 |