methyl 3,5-dihydroxy-4-phenylmethoxybenzoate structure
|
Common Name | methyl 3,5-dihydroxy-4-phenylmethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 91925-82-5 | Molecular Weight | 274.26900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3,5-dihydroxy-4-phenylmethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14O5 |
|---|---|
| Molecular Weight | 274.26900 |
| Exact Mass | 274.08400 |
| PSA | 75.99000 |
| LogP | 2.46340 |
| InChIKey | HXUGADXSKBFNMU-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(O)c(OCc2ccccc2)c(O)c1 |
| HS Code | 2918990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| hms2273a18 |