N-[4-[[(6-amino-5-nitropyridin-2-yl)amino]methyl]phenyl]acetamide structure
|
Common Name | N-[4-[[(6-amino-5-nitropyridin-2-yl)amino]methyl]phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 91941-10-5 | Molecular Weight | 301.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-[[(6-amino-5-nitropyridin-2-yl)amino]methyl]phenyl]acetamide |
|---|
| Molecular Formula | C14H15N5O3 |
|---|---|
| Molecular Weight | 301.30100 |
| Exact Mass | 301.11700 |
| PSA | 132.58000 |
| LogP | 3.31830 |
| InChIKey | AGSWBURZLFVGIG-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(CNc2ccc([N+](=O)[O-])c(N)n2)cc1 |
|
~%
N-[4-[[(6-amino... CAS#:91941-10-5 |
| Literature: Seydel; Schaper; Coats; Cordes Journal of Medicinal Chemistry, 1994 , vol. 37, # 19 p. 3016 - 3022 |
|
~%
N-[4-[[(6-amino... CAS#:91941-10-5 |
| Literature: Seydel; Schaper; Coats; Cordes Journal of Medicinal Chemistry, 1994 , vol. 37, # 19 p. 3016 - 3022 |