3-phenyl-3-propyl-pyrrolidine-2,5-dione structure
|
Common Name | 3-phenyl-3-propyl-pyrrolidine-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 91957-49-2 | Molecular Weight | 217.26400 | |
| Density | 1.117g/cm3 | Boiling Point | 391ºC at 760 mmHg | |
| Molecular Formula | C13H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.5ºC | |
| Name | 3-phenyl-3-propylpyrrolidine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.117g/cm3 |
|---|---|
| Boiling Point | 391ºC at 760 mmHg |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.26400 |
| Flash Point | 160.5ºC |
| Exact Mass | 217.11000 |
| PSA | 46.17000 |
| LogP | 2.09980 |
| Index of Refraction | 1.533 |
| InChIKey | SDSNEIRXAUSJRT-UHFFFAOYSA-N |
| SMILES | CCCC1(c2ccccc2)CC(=O)NC1=O |
|
~%
3-phenyl-3-prop... CAS#:91957-49-2 |
| Literature: Miller; Long Journal of the American Chemical Society, 1951 , vol. 73, p. 4895,4897 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-phenyl-3-propyl-pyrrolidine-2,5-dione |
| 3-Phenyl-3-propyl-pyrrolidin-2,5-dion |
| 2-Phenyl-2-propylbernsteinsaeureimid |