N-(4-Formyl-1,3-thiazol-2-yl)-N-phenylacetamide structure
|
Common Name | N-(4-Formyl-1,3-thiazol-2-yl)-N-phenylacetamide | ||
|---|---|---|---|---|
| CAS Number | 91973-74-9 | Molecular Weight | 246.28500 | |
| Density | 1.353g/cm3 | Boiling Point | 405.1ºC at 760mmHg | |
| Molecular Formula | C12H10N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.8ºC | |
| Name | N-(4-Formyl-1,3-thiazol-2-yl)-N-phenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.353g/cm3 |
|---|---|
| Boiling Point | 405.1ºC at 760mmHg |
| Molecular Formula | C12H10N2O2S |
| Molecular Weight | 246.28500 |
| Flash Point | 198.8ºC |
| Exact Mass | 246.04600 |
| PSA | 78.51000 |
| LogP | 2.64020 |
| Index of Refraction | 1.672 |
| InChIKey | UPSVWABECCOHRT-UHFFFAOYSA-N |
| SMILES | CC(=O)N(c1ccccc1)c1nc(C=O)cs1 |
| HS Code | 2934100090 |
|---|
|
~%
N-(4-Formyl-1,3... CAS#:91973-74-9 |
| Literature: Simiti,I. et al. Chemische Berichte, 1962 , vol. 95, p. 2672 - 2679 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-<N-Acetyl-anilino>-4-formyl-thiazol |
| N-(4-formyl-thiazol-2-yl)-N-phenyl-acetamide |