5,5'-dichloro-2,2',4,4'-tetramethoxy-alpha,alpha'-terephthaloyldiacetanilide structure
|
Common Name | 5,5'-dichloro-2,2',4,4'-tetramethoxy-alpha,alpha'-terephthaloyldiacetanilide | ||
|---|---|---|---|---|
| CAS Number | 92-21-7 | Molecular Weight | 589.42100 | |
| Density | 1.379g/cm3 | Boiling Point | 821.7ºC at 760 mmHg | |
| Molecular Formula | C28H26Cl2N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 450.7ºC | |
| Name | a,a'-terephthaloylbis-5-chloro-2,4-dimethoxyacetanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.379g/cm3 |
|---|---|
| Boiling Point | 821.7ºC at 760 mmHg |
| Molecular Formula | C28H26Cl2N2O8 |
| Molecular Weight | 589.42100 |
| Flash Point | 450.7ºC |
| Exact Mass | 588.10700 |
| PSA | 129.26000 |
| LogP | 5.59680 |
| Index of Refraction | 1.621 |
| InChIKey | RGJDBFYBXKHCEV-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(NC(=O)CC(=O)c2ccc(C(=O)CC(=O)Nc3cc(Cl)c(OC)cc3OC)cc2)cc1Cl |
| HS Code | 2924299090 |
|---|
|
~%
5,5'-dichloro-2... CAS#:92-21-7 |
| Literature: Gen.Aniline Works Patent: US1971409 , 1933 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,3'-dioxo-3,3'-p-phenylene-di-propionic acid bis-(5-chloro-2,4-dimethoxy-anilide) |
| NAPHTHOL AS-LG |
| Naphtol AS-LG |
| C.I.Azoic Coupling Component 35 |
| 1.4-Bis-[(5-chlor-2.4-dimethoxy-phenylcarbamoyl)-acetyl]-benzol |
| alphaalpha-terephthaloylbis-5-chloro-2,4-dimethoxyacetanilide |
| 3,3'-(1,4-Phenylene)bis[N-(5-chloro-2,4-dimethoxyphenyl)-3-oxopropanamide] |
| 3,3'-Dioxo-3,3'-p-phenylen-di-propionsaeure-bis-(5-chlor-2,4-dimethoxy-anilid) |