4'-Chloro-3-hydroxy-2'-methyl-2-naphthanilide
Modify Date: 2025-08-30 02:17:30
4'-Chloro-3-hydroxy-2'-methyl-2-naphthanilide structure
|
Common Name | 4'-Chloro-3-hydroxy-2'-methyl-2-naphthanilide | ||
|---|---|---|---|---|
| CAS Number | 92-76-2 | Molecular Weight | 311.76200 | |
| Density | 1.36 g/cm3 | Boiling Point | 426.1ºC at 760 mmHg | |
| Molecular Formula | C18H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4'-Chloro-3-hydroxy-2'-methyl-2-naphthanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36 g/cm3 |
|---|---|
| Boiling Point | 426.1ºC at 760 mmHg |
| Molecular Formula | C18H14ClNO2 |
| Molecular Weight | 311.76200 |
| Exact Mass | 311.07100 |
| PSA | 49.33000 |
| LogP | 4.83250 |
| Index of Refraction | 1.717 |
| InChIKey | PSRNXESQSJEQMN-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)ccc1NC(=O)c1cc2ccccc2cc1O |
| HS Code | 2924299090 |
|---|
|
~%
4'-Chloro-3-hyd... CAS#:92-76-2 |
| Literature: Journal of the Society of Dyers and Colourists, , vol. 42, p. 82 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| Tulathol AS-TR. |
| naphtholas-trpurifiedcrystalline |
| Azoic C.C.8 |
| Naftol AS-TR |
| 3-hydroxy-naphthalene-2-carboxylic acid 4-chloro-2-methyl-anilide |
| NAPHTHOLAS-TR6 |
| EINECS 202-187-6 |
| C.I.Azoic Coupling Component 8 |
| naphthol ASTR |
| Amarthol AS-TR |
| Azoic coupling component 8 |