1-(1-benzyl-2-methylimidazol-4-yl)ethanone
1-(1-benzyl-2-methylimidazol-4-yl)ethanone structure
|
Common Name | 1-(1-benzyl-2-methylimidazol-4-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 92007-22-2 | Molecular Weight | 214.26300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(1-benzyl-2-methylimidazol-4-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H14N2O |
|---|---|
| Molecular Weight | 214.26300 |
| Exact Mass | 214.11100 |
| PSA | 34.89000 |
| LogP | 2.44240 |
| InChIKey | YNKDPLUKKFQWBM-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cn(Cc2ccccc2)c(C)n1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~77%
1-(1-benzyl-2-m... CAS#:92007-22-2 |
| Literature: Reiter, Lawrence A. Journal of Organic Chemistry, 1987 , vol. 52, # 13 p. 2714 - 2726 |
|
~%
1-(1-benzyl-2-m... CAS#:92007-22-2 |
| Literature: Reiter, Lawrence A. Journal of Organic Chemistry, 1987 , vol. 52, # 13 p. 2714 - 2726 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-acetyl-1-benzyl-2-methylimidazole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-(1-benzyl-2-methylimidazol-4-yl)ethanone? |
| A: Molecular formula of 1-(1-benzyl-2-methylimidazol-4-yl)ethanone is C13H14N2O. |
| Q: What is the InChIKey of 1-(1-benzyl-2-methylimidazol-4-yl)ethanone? |
| A: InChIKey of 1-(1-benzyl-2-methylimidazol-4-yl)ethanone is YNKDPLUKKFQWBM-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-(1-benzyl-2-methylimidazol-4-yl)ethanone? |
| A: CAS number of 1-(1-benzyl-2-methylimidazol-4-yl)ethanone is 92007-22-2. |
| Q: What is the molecular weight of 1-(1-benzyl-2-methylimidazol-4-yl)ethanone? |
| A: Molecular weight of 1-(1-benzyl-2-methylimidazol-4-yl)ethanone is 214.26300. |
| Q: What is the LogP of 1-(1-benzyl-2-methylimidazol-4-yl)ethanone? |
| A: LogP of 1-(1-benzyl-2-methylimidazol-4-yl)ethanone is 2.44240. |
| Q: What is the English name of 1-(1-benzyl-2-methylimidazol-4-yl)ethanone? |
| A: The English name of 1-(1-benzyl-2-methylimidazol-4-yl)ethanone is 1-(1-benzyl-2-methylimidazol-4-yl)ethanone. |
| Q: What is the polar surface area (PSA) of 1-(1-benzyl-2-methylimidazol-4-yl)ethanone? |
| A: Polar surface area (PSA) of 1-(1-benzyl-2-methylimidazol-4-yl)ethanone is 34.89000. |
| Q: What English synonyms does 1-(1-benzyl-2-methylimidazol-4-yl)ethanone have? |
| A: English synonyms of 1-(1-benzyl-2-methylimidazol-4-yl)ethanone: 4-acetyl-1-benzyl-2-methylimidazole. |
| Q: What is the SMILES notation of 1-(1-benzyl-2-methylimidazol-4-yl)ethanone? |
| A: SMILES notation of 1-(1-benzyl-2-methylimidazol-4-yl)ethanone is CC(=O)c1cn(Cc2ccccc2)c(C)n1. |