trimethyl-(1-trimethylsilylcyclopropa[b]naphthalen-1-yl)silane structure
|
Common Name | trimethyl-(1-trimethylsilylcyclopropa[b]naphthalen-1-yl)silane | ||
|---|---|---|---|---|
| CAS Number | 92012-56-1 | Molecular Weight | 284.54300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H24Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-(1-trimethylsilylcyclopropa[b]naphthalen-1-yl)silane |
|---|
| Molecular Formula | C17H24Si2 |
|---|---|
| Molecular Weight | 284.54300 |
| Exact Mass | 284.14200 |
| LogP | 5.50560 |
| InChIKey | UYXLVIZLVIRJQG-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1([Si](C)(C)C)c2cc3ccccc3cc21 |
|
~67%
trimethyl-(1-tr... CAS#:92012-56-1 |
| Literature: Halton,B.; Randall,C.J.; Gainsford,G.J. Journal of the American Chemical Society, 1986 , vol. 108, p. 5949 |