N1-(3-chloro-4-methylphenyl)-N2-(3-methoxyphenethyl)oxalamide
Modify Date: 2026-08-02 17:49:19
N1-(3-chloro-4-methylphenyl)-N2-(3-methoxyphenethyl)oxalamide structure
|
Common Name | N1-(3-chloro-4-methylphenyl)-N2-(3-methoxyphenethyl)oxalamide | ||
|---|---|---|---|---|
| CAS Number | 920175-39-9 | Molecular Weight | 346.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H19ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N1-(3-chloro-4-methylphenyl)-N2-(3-methoxyphenethyl)oxalamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H19ClN2O3 |
|---|---|
| Molecular Weight | 346.8 |
| InChIKey | BOOJKNJBPGTMGX-UHFFFAOYSA-N |
| SMILES | COc1cccc(CCNC(=O)C(=O)Nc2ccc(C)c(Cl)c2)c1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N1-(3-chloro-4-methylphenyl)-N2-(3-methoxyphenethyl)oxalamide? |
| A: The English name of N1-(3-chloro-4-methylphenyl)-N2-(3-methoxyphenethyl)oxalamide is N1-(3-chloro-4-methylphenyl)-N2-(3-methoxyphenethyl)oxalamide. |
| Q: What is the molecular formula of N1-(3-chloro-4-methylphenyl)-N2-(3-methoxyphenethyl)oxalamide? |
| A: Molecular formula of N1-(3-chloro-4-methylphenyl)-N2-(3-methoxyphenethyl)oxalamide is C18H19ClN2O3. |
| Q: What is the SMILES notation of N1-(3-chloro-4-methylphenyl)-N2-(3-methoxyphenethyl)oxalamide? |
| A: SMILES notation of N1-(3-chloro-4-methylphenyl)-N2-(3-methoxyphenethyl)oxalamide is COc1cccc(CCNC(=O)C(=O)Nc2ccc(C)c(Cl)c2)c1. |
| Q: What is the molecular weight of N1-(3-chloro-4-methylphenyl)-N2-(3-methoxyphenethyl)oxalamide? |
| A: Molecular weight of N1-(3-chloro-4-methylphenyl)-N2-(3-methoxyphenethyl)oxalamide is 346.8. |
| Q: What is the Chinese name of 920175-39-9? |
| A: Chinese name of 920175-39-9 is 920175-39-9. |
| Q: What is the CAS number of N1-(3-chloro-4-methylphenyl)-N2-(3-methoxyphenethyl)oxalamide? |
| A: CAS number of N1-(3-chloro-4-methylphenyl)-N2-(3-methoxyphenethyl)oxalamide is 920175-39-9. |
| Q: What is the InChIKey of N1-(3-chloro-4-methylphenyl)-N2-(3-methoxyphenethyl)oxalamide? |
| A: InChIKey of N1-(3-chloro-4-methylphenyl)-N2-(3-methoxyphenethyl)oxalamide is BOOJKNJBPGTMGX-UHFFFAOYSA-N. |