N1-(3-chloro-4-methylphenyl)-N2-(3-methoxyphenethyl)oxalamide
Modify Date: 2025-10-02 14:31:20
N1-(3-chloro-4-methylphenyl)-N2-(3-methoxyphenethyl)oxalamide structure
|
Common Name | N1-(3-chloro-4-methylphenyl)-N2-(3-methoxyphenethyl)oxalamide | ||
|---|---|---|---|---|
| CAS Number | 920175-39-9 | Molecular Weight | 346.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H19ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N1-(3-chloro-4-methylphenyl)-N2-(3-methoxyphenethyl)oxalamide |
|---|
| Molecular Formula | C18H19ClN2O3 |
|---|---|
| Molecular Weight | 346.8 |
| InChIKey | BOOJKNJBPGTMGX-UHFFFAOYSA-N |
| SMILES | COc1cccc(CCNC(=O)C(=O)Nc2ccc(C)c(Cl)c2)c1 |
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
Total 2, Current Page 1 of 1
1