Benzeneacetic acid, a-bromo-, 3-methylbutyl ester structure
|
Common Name | Benzeneacetic acid, a-bromo-, 3-methylbutyl ester | ||
|---|---|---|---|---|
| CAS Number | 92018-48-9 | Molecular Weight | 285.17700 | |
| Density | 1.281g/cm3 | Boiling Point | 313.5ºC at 760mmHg | |
| Molecular Formula | C13H17BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.4ºC | |
| Name | 3-methylbutyl 2-bromo-2-phenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.281g/cm3 |
|---|---|
| Boiling Point | 313.5ºC at 760mmHg |
| Molecular Formula | C13H17BrO2 |
| Molecular Weight | 285.17700 |
| Flash Point | 143.4ºC |
| Exact Mass | 284.04100 |
| PSA | 26.30000 |
| LogP | 3.71190 |
| Index of Refraction | 1.527 |
| InChIKey | CKPGTYLPMYKUDW-UHFFFAOYSA-N |
| SMILES | CC(C)CCOC(=O)C(Br)c1ccccc1 |
|
~%
Benzeneacetic a... CAS#:92018-48-9 |
| Literature: Ghielmetti Farmaco (1946-1952), 1952 , vol. 7, p. 625,628 |
|
~%
Benzeneacetic a... CAS#:92018-48-9 |
| Literature: Edwards,B.K. et al. Journal of Pharmacy and Pharmacology, 1960 , vol. 12, p. 179 - 186 |
|
~%
Benzeneacetic a... CAS#:92018-48-9 |
| Literature: Klosa Archiv der Pharmazie (Weinheim, Germany), 1952 , vol. 285, p. 327,331 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| bromo-phenyl-acetic acid isopentyl ester |
| Brom-phenyl-essigsaeure-isopentylester |