1-(3-isopropoxypropyl)-4-thioxo-3,4,5,6,7,8-hexahydroquinazolin-2(1H)-one
Modify Date: 2025-10-05 21:15:10
1-(3-isopropoxypropyl)-4-thioxo-3,4,5,6,7,8-hexahydroquinazolin-2(1H)-one structure
|
Common Name | 1-(3-isopropoxypropyl)-4-thioxo-3,4,5,6,7,8-hexahydroquinazolin-2(1H)-one | ||
|---|---|---|---|---|
| CAS Number | 920368-47-4 | Molecular Weight | 282.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(3-isopropoxypropyl)-4-thioxo-3,4,5,6,7,8-hexahydroquinazolin-2(1H)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H22N2O2S |
|---|---|
| Molecular Weight | 282.40 |
| InChIKey | FLXPVBCDSDDFKU-UHFFFAOYSA-N |
| SMILES | CC(C)OCCCn1c2c(c(=S)[nH]c1=O)CCCC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-(3-isopropoxypropyl)-4-thioxo-3,4,5,6,7,8-hexahydroquinazolin-2(1H)-one? |
| A: Molecular formula of 1-(3-isopropoxypropyl)-4-thioxo-3,4,5,6,7,8-hexahydroquinazolin-2(1H)-one is C14H22N2O2S. |
| Q: What is the SMILES notation of 1-(3-isopropoxypropyl)-4-thioxo-3,4,5,6,7,8-hexahydroquinazolin-2(1H)-one? |
| A: SMILES notation of 1-(3-isopropoxypropyl)-4-thioxo-3,4,5,6,7,8-hexahydroquinazolin-2(1H)-one is CC(C)OCCCn1c2c(c(=S)[nH]c1=O)CCCC2. |
| Q: What is the InChIKey of 1-(3-isopropoxypropyl)-4-thioxo-3,4,5,6,7,8-hexahydroquinazolin-2(1H)-one? |
| A: InChIKey of 1-(3-isopropoxypropyl)-4-thioxo-3,4,5,6,7,8-hexahydroquinazolin-2(1H)-one is FLXPVBCDSDDFKU-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-(3-isopropoxypropyl)-4-thioxo-3,4,5,6,7,8-hexahydroquinazolin-2(1H)-one? |
| A: Molecular weight of 1-(3-isopropoxypropyl)-4-thioxo-3,4,5,6,7,8-hexahydroquinazolin-2(1H)-one is 282.40. |
| Q: What is the CAS number of 1-(3-isopropoxypropyl)-4-thioxo-3,4,5,6,7,8-hexahydroquinazolin-2(1H)-one? |
| A: CAS number of 1-(3-isopropoxypropyl)-4-thioxo-3,4,5,6,7,8-hexahydroquinazolin-2(1H)-one is 920368-47-4. |
| Q: What is the English name of 1-(3-isopropoxypropyl)-4-thioxo-3,4,5,6,7,8-hexahydroquinazolin-2(1H)-one? |
| A: The English name of 1-(3-isopropoxypropyl)-4-thioxo-3,4,5,6,7,8-hexahydroquinazolin-2(1H)-one is 1-(3-isopropoxypropyl)-4-thioxo-3,4,5,6,7,8-hexahydroquinazolin-2(1H)-one. |
| Q: What is the Chinese name of 920368-47-4? |
| A: Chinese name of 920368-47-4 is 920368-47-4. |