ethyl 3-oxo-2-(2-pyridin-2-ylethyl)butanoate structure
|
Common Name | ethyl 3-oxo-2-(2-pyridin-2-ylethyl)butanoate | ||
|---|---|---|---|---|
| CAS Number | 92041-81-1 | Molecular Weight | 235.27900 | |
| Density | 1.091g/cm3 | Boiling Point | 361.2ºC at 760 mmHg | |
| Molecular Formula | C13H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.2ºC | |
| Name | ethyl 3-oxo-2-(2-pyridin-2-ylethyl)butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.091g/cm3 |
|---|---|
| Boiling Point | 361.2ºC at 760 mmHg |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.27900 |
| Flash Point | 172.2ºC |
| Exact Mass | 235.12100 |
| PSA | 56.26000 |
| LogP | 1.78250 |
| Index of Refraction | 1.5 |
| InChIKey | HXTPGVVMOXURSQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CCc1ccccn1)C(C)=O |
|
~%
ethyl 3-oxo-2-(... CAS#:92041-81-1 |
| Literature: Boekelheide; Rothchild Journal of the American Chemical Society, 1949 , vol. 71, p. 879,882 |
| ethyl 2-acetyl-4-pirydylbutyrate |