3,3,7,7-tetramethyl-1,5,3,7-diselenadisilocane structure
|
Common Name | 3,3,7,7-tetramethyl-1,5,3,7-diselenadisilocane | ||
|---|---|---|---|---|
| CAS Number | 920513-66-2 | Molecular Weight | 330.33500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H20Se2Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3,7,7-tetramethyl-1,5,3,7-diselenadisilocane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H20Se2Si2 |
|---|---|
| Molecular Weight | 330.33500 |
| Exact Mass | 331.94300 |
| LogP | 2.65520 |
| InChIKey | LEPXPEPYJISXDD-UHFFFAOYSA-N |
| SMILES | C[Si]1(C)C[Se]C[Si](C)(C)C[Se]C1 |
|
~75%
3,3,7,7-tetrame... CAS#:920513-66-2 |
| Literature: Block, Eric; Dikarev, Evgeny V.; Glass, Richard S.; Jin, Jin; Li, Bo; Li, Xiaojie; Zhang, Shao-Zhong Journal of the American Chemical Society, 2006 , vol. 128, # 46 p. 14949 - 14961 |
| 1,5-Diselena-3,7-disilacyclooctane,3,3,7,7-tetramethyl |
| 3,3,7,7-tetramethyl-1,5-diselena-3,7-disilocane |