methyl 1-(6-oxoheptyl)indole-3-carboxylate structure
|
Common Name | methyl 1-(6-oxoheptyl)indole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 920513-99-1 | Molecular Weight | 287.35400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 1-(6-oxoheptyl)indole-3-carboxylate |
|---|
| Molecular Formula | C17H21NO3 |
|---|---|
| Molecular Weight | 287.35400 |
| Exact Mass | 287.15200 |
| PSA | 48.30000 |
| LogP | 3.57730 |
| InChIKey | KIIUPQKPHFUONN-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cn(CCCCCC(C)=O)c2ccccc12 |
|
~%
methyl 1-(6-oxo... CAS#:920513-99-1 |
| Literature: Blot, Virginie; Reissig, Hans-Ulrich European Journal of Organic Chemistry, 2006 , # 22 p. 4989 - 4992 |
|
~%
methyl 1-(6-oxo... CAS#:920513-99-1 |
| Literature: Blot, Virginie; Reissig, Hans-Ulrich European Journal of Organic Chemistry, 2006 , # 22 p. 4989 - 4992 |