(2,4-dibromo-6-phenyl-phenyl)imino-imino-azanium structure
|
Common Name | (2,4-dibromo-6-phenyl-phenyl)imino-imino-azanium | ||
|---|---|---|---|---|
| CAS Number | 92059-22-8 | Molecular Weight | 353.01200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H7Br2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-azido-1,5-dibromo-3-phenylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H7Br2N3 |
|---|---|
| Molecular Weight | 353.01200 |
| Exact Mass | 350.90100 |
| PSA | 49.75000 |
| LogP | 5.27316 |
| InChIKey | QRGATRIOODMXSS-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=Nc1c(Br)cc(Br)cc1-c1ccccc1 |
|
~%
(2,4-dibromo-6-... CAS#:92059-22-8 |
| Literature: Smith; Brown Journal of the American Chemical Society, 1951 , vol. 73, p. 2435 |
|
~%
(2,4-dibromo-6-... CAS#:92059-22-8 |
| Literature: Smith; Brown Journal of the American Chemical Society, 1951 , vol. 73, p. 2435 |
|
~%
(2,4-dibromo-6-... CAS#:92059-22-8 |
| Literature: Smith; Brown Journal of the American Chemical Society, 1951 , vol. 73, p. 2435 |
|
~%
(2,4-dibromo-6-... CAS#:92059-22-8 |
| Literature: Smith; Brown Journal of the American Chemical Society, 1951 , vol. 73, p. 2435 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3.5-Dibrom-2-azidobiphenyl |
| 2-azido-3,5-dibromo-biphenyl |
| 2-Azido-3,5-dibrom-biphenyl |