1-nitro-2-[2-(4-nitrophenyl)ethyl]benzene structure
|
Common Name | 1-nitro-2-[2-(4-nitrophenyl)ethyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 92085-83-1 | Molecular Weight | 272.25600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-nitro-2-[2-(4-nitrophenyl)ethyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12N2O4 |
|---|---|
| Molecular Weight | 272.25600 |
| Exact Mass | 272.08000 |
| PSA | 91.64000 |
| LogP | 4.33460 |
| InChIKey | AXIZPDWIUAIAIV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CCc2ccccc2[N+](=O)[O-])cc1 |
|
~%
1-nitro-2-[2-(4... CAS#:92085-83-1
Detail
|
| Literature: Suzuki, Hitomi; Mori, Tadashi Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1997 , # 7 p. 1265 - 1274 |
|
~%
1-nitro-2-[2-(4... CAS#:92085-83-1 |
| Literature: Stelling; Fittig Justus Liebigs Annalen der Chemie, 1866 , vol. 137, p. 258 |
| 2,4'-dinitro-bibenzyl |