3,4-dimethyl-1,1-bis(2,4,6-trimethylphenoxy)-2,5-dihydrogermole structure
|
Common Name | 3,4-dimethyl-1,1-bis(2,4,6-trimethylphenoxy)-2,5-dihydrogermole | ||
|---|---|---|---|---|
| CAS Number | 921201-57-2 | Molecular Weight | 425.15000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H32GeO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,4-dimethyl-1,1-bis(2,4,6-trimethylphenoxy)-2,5-dihydrogermole |
|---|
| Molecular Formula | C24H32GeO2 |
|---|---|
| Molecular Weight | 425.15000 |
| Exact Mass | 426.16100 |
| PSA | 18.46000 |
| LogP | 6.78700 |
| InChIKey | WAXWUUDHRZILAH-UHFFFAOYSA-N |
| SMILES | CC1=C(C)C[Ge](Oc2c(C)cc(C)cc2C)(Oc2c(C)cc(C)cc2C)C1 |
|
~17%
3,4-dimethyl-1,... CAS#:921201-57-2 |
| Literature: Bonnefille, Eric; Mazieres, Stephane; Hawi, Nancy El; Gornitzka, Heinz; Couret, Claude Journal of Organometallic Chemistry, 2006 , vol. 691, p. 5619 - 5625 |
|
~%
3,4-dimethyl-1,... CAS#:921201-57-2 |
| Literature: Bonnefille, Eric; Mazieres, Stephane; Hawi, Nancy El; Gornitzka, Heinz; Couret, Claude Journal of Organometallic Chemistry, 2006 , vol. 691, p. 5619 - 5625 |