3,3'-[5'-[3-(3-Pyridinyl)phenyl][1,1':3',1''-terphenyl]-3,3''-diyl]bispyridine structure
|
Common Name | 3,3'-[5'-[3-(3-Pyridinyl)phenyl][1,1':3',1''-terphenyl]-3,3''-diyl]bispyridine | ||
|---|---|---|---|---|
| CAS Number | 921205-03-0 | Molecular Weight | 537.652 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 748.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C39H27N3 | Melting Point | 195-200 ℃ | |
| MSDS | USA | Flash Point | 314.2±24.5 °C | |
| Name | 3-[3-[3,5-bis(3-pyridin-3-ylphenyl)phenyl]phenyl]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 748.9±55.0 °C at 760 mmHg |
| Melting Point | 195-200 ℃ |
| Molecular Formula | C39H27N3 |
| Molecular Weight | 537.652 |
| Flash Point | 314.2±24.5 °C |
| Exact Mass | 537.220520 |
| PSA | 38.67000 |
| LogP | 10.53 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | CINYXYWQPZSTOT-UHFFFAOYSA-N |
| SMILES | c1cncc(-c2cccc(-c3cc(-c4cccc(-c5cccnc5)c4)cc(-c4cccc(-c5cccnc5)c4)c3)c2)c1 |
| RIDADR | NONH for all modes of transport |
|---|
|
Pyridine-containing triphenylbenzene derivatives with high electron mobility for highly efficient phosphorescent OLEDs Su, Shi-Jian; Chiba, Takayuki; et al.
Adv. Mater. (Weinheim, Germany) 20(11) , 2125-2130, (2008)
|
|
|
Structure-property relationship of pyridine-containing triphenyl benzene electron-transport materials for highly efficient blue phosphorescent OLEDs Su, Shi-Jian; Takahashi, Yasuyuki; et al.
Adv. Funct. Mater. 19(8) , 1260-1267, (2009)
|
| 1,3,5-tri(m-pyrid-3-yl-phenyl)benzene |
| 3,3'-[5'-[3-(3-Pyridinyl)phenyl][1,1':3',1''-terphenyl]-3,3''-diyl]bispyridine |