Mannitol, 2,3:4,5-di-O-isopropylidene- (7CI) structure
|
Common Name | Mannitol, 2,3:4,5-di-O-isopropylidene- (7CI) | ||
|---|---|---|---|---|
| CAS Number | 92142-08-0 | Molecular Weight | 262.29900 | |
| Density | 1.144g/cm3 | Boiling Point | 362.4ºC at 760mmHg | |
| Molecular Formula | C12H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173ºC | |
| Name | 1-[2-[2-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]ethoxy]ethyl]piperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.144g/cm3 |
|---|---|
| Boiling Point | 362.4ºC at 760mmHg |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.29900 |
| Flash Point | 173ºC |
| Exact Mass | 262.14200 |
| PSA | 77.38000 |
| LogP | 0.01120 |
| Index of Refraction | 1.463 |
| InChIKey | FLXVQAMRSMZNMN-UHFFFAOYSA-N |
| SMILES | CC1(C)OC(CO)C(C2OC(C)(C)OC2CO)O1 |
|
~%
Mannitol, 2,3:4... CAS#:92142-08-0 |
| Literature: Angyal et al. Journal of the Chemical Society, 1953 , p. 3321 |
|
~%
Mannitol, 2,3:4... CAS#:92142-08-0 |
| Literature: Angyal et al. Journal of the Chemical Society, 1953 , p. 3321 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| O2,O3,O4,O5-diisopropylidene-L-mannitol |
| Piperidine,1-(2-(2-(2-(thymyloxy)ethoxy)ethoxy)ethyl) |
| 1-(2-(2-(2-(Thymyloxy)ethoxy)ethoxy)ethyl)piperidine |
| O2,O3,O4,O5-Diisopropyliden-L-mannit |
| 1-[2-(2-{2-[5-methyl-2-(propan-2-yl)phenoxy]ethoxy}ethoxy)ethyl]piperidine |