3-(4-methylphenyl)-1H-benzimidazole-2-thione
Modify Date: 2025-09-28 13:00:15
3-(4-methylphenyl)-1H-benzimidazole-2-thione structure
|
Common Name | 3-(4-methylphenyl)-1H-benzimidazole-2-thione | ||
|---|---|---|---|---|
| CAS Number | 92149-91-2 | Molecular Weight | 240.32300 | |
| Density | 1.31g/cm3 | Boiling Point | 397.3ºC at 760mmHg | |
| Molecular Formula | C14H12N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.1ºC | |
| Name | 3-(4-methylphenyl)-1H-benzimidazole-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 397.3ºC at 760mmHg |
| Molecular Formula | C14H12N2S |
| Molecular Weight | 240.32300 |
| Flash Point | 194.1ºC |
| Exact Mass | 240.07200 |
| PSA | 56.62000 |
| LogP | 3.62260 |
| Index of Refraction | 1.733 |
| InChIKey | FHXWTJWSGIXRKE-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-n2c(=S)[nH]c3ccccc32)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-p-Tolyl-1H-benzoimidazole-2-thiol |
| 1-p-tolyl-1,3-dihydro-benzoimidazole-2-thione |
| 2-Mercapto-1-p-tolyl-benzimidazol |