5-(2,4-DICHLOROPHENYL)-4-PHENYL-4H-1,2,4-TRIAZOLE-3-THIOL structure
|
Common Name | 5-(2,4-DICHLOROPHENYL)-4-PHENYL-4H-1,2,4-TRIAZOLE-3-THIOL | ||
|---|---|---|---|---|
| CAS Number | 92151-02-5 | Molecular Weight | 322.21200 | |
| Density | 1.46g/cm3 | Boiling Point | 420.5ºC at 760mmHg | |
| Molecular Formula | C14H9Cl2N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.1ºC | |
| Name | 3-(2,4-dichlorophenyl)-4-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 420.5ºC at 760mmHg |
| Molecular Formula | C14H9Cl2N3S |
| Molecular Weight | 322.21200 |
| Flash Point | 208.1ºC |
| Exact Mass | 320.98900 |
| PSA | 69.51000 |
| LogP | 4.52980 |
| Index of Refraction | 1.71 |
| InChIKey | FZHHEYHBLWXVLF-UHFFFAOYSA-N |
| SMILES | S=c1[nH]nc(-c2ccc(Cl)cc2Cl)n1-c1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(2,4-Dichlorophenyl)-4-phenyl-1,2,4-triazole-5-thiol |
| 5-(2,4-Dichloro-phenyl)-4-phenyl-2,4-dihydro-[1,2,4]triazole-3-thione |
| 5-(2,4-dichlorophenyl)-4-phenyl-4H-1,2,4-triazole-3-thiol |
| 4h-1,2,4-triazole-3-thiol,5-(2,4-dichlorophenyl)-4-phenyl |
| 5-(2,4-dichlorophenyl)-4-phenyl-2,4-dihydro-3H-1,2,4-triazole-3-thione |
| 5-(2,4-dichlorophenyl)-4-phenyl-1,2,4-triazole-3-thiol |