ethyl N-(2,3,5,6-tetramethylphenyl)carbamate
Modify Date: 2024-12-02 10:24:59
ethyl N-(2,3,5,6-tetramethylphenyl)carbamate structure
|
Common Name | ethyl N-(2,3,5,6-tetramethylphenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 92196-96-8 | Molecular Weight | 221.29500 | |
| Density | 1.051g/cm3 | Boiling Point | 276.5ºC at 760 mmHg | |
| Molecular Formula | C13H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121ºC | |
| Name | 2,3,5,6-Tetramethylphenyl-methan |
|---|
| Density | 1.051g/cm3 |
|---|---|
| Boiling Point | 276.5ºC at 760 mmHg |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.29500 |
| Flash Point | 121ºC |
| Exact Mass | 221.14200 |
| PSA | 38.33000 |
| LogP | 3.56160 |
| Index of Refraction | 1.541 |
| InChIKey | BUGOEFSORRDCJQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1c(C)c(C)cc(C)c1C |
|
~%
ethyl N-(2,3,5,... CAS#:92196-96-8 |
| Literature: Weizmann Journal of the American Chemical Society, 1948 , vol. 70, p. 2342 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |