sodium diamyl sulfosuccinate structure
|
Common Name | sodium diamyl sulfosuccinate | ||
|---|---|---|---|---|
| CAS Number | 922-80-5 | Molecular Weight | 360.39900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H25NaO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,1,4-dioxo-1,4-dipentoxybutane-2-sulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H25NaO7S |
|---|---|
| Molecular Weight | 360.39900 |
| Exact Mass | 360.12200 |
| PSA | 118.18000 |
| LogP | 2.83790 |
| InChIKey | UMEWSJNRBXKWKZ-UHFFFAOYSA-M |
| SMILES | CCCCCOC(=O)CC(C(=O)OCCCCC)S(=O)(=O)[O-].[Na+] |
| HS Code | 2914509090 |
|---|
|
~96%
sodium diamyl s... CAS#:922-80-5 |
| Literature: Liu, Zhao-Tie; Liu, Ling; Wu, Jin; Song, Liping; Gao, Ziwei; Dong, Wensheng; Lu, Jian Journal of Chemical and Engineering Data, 2006 , vol. 51, # 6 p. 2045 - 2050 |
|
~%
sodium diamyl s... CAS#:922-80-5 |
| Literature: Liu, Zhao-Tie; Wu, Jin; Liu, Ling; Sun, Changan; Song, Liping; Gao, Ziwei; Dong, Wensheng; Lu, Jian Journal of Chemical and Engineering Data, 2006 , vol. 51, # 5 p. 1761 - 1768 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,2-Bis-pentyloxycarbonyl-aethansulfonsaeure,Natrium-Salz |
| Sodium 1,4-dipentyl sulfobutanedioic acid |
| Sulfosuccinic acid,dipentyl ester,sodium salt |
| SODIUM DIAMYL SULFOSUCCINATE,PRACT |
| sodium dipentylsulfosuccinate |
| Butanedioic acid,sulfo-,1,4-dipentyl ester,sodium salt |
| Diamyl sodium sulfosuccinate |
| EINECS 213-085-6 |
| aerosol ay |
| sodium diamyl sulfosuccinate |
| di-n-pentyl 2-sulfosuccinate sodium salt |
| 1,2-bis-pentyloxycarbonyl-ethanesulfonic acid,sodium-salt |