N1-(3,4-dimethoxyphenyl)-N2-(2-(1-methylindolin-5-yl)-2-morpholinoethyl)oxalamide
Modify Date: 2026-07-07 13:30:31
N1-(3,4-dimethoxyphenyl)-N2-(2-(1-methylindolin-5-yl)-2-morpholinoethyl)oxalamide structure
|
Common Name | N1-(3,4-dimethoxyphenyl)-N2-(2-(1-methylindolin-5-yl)-2-morpholinoethyl)oxalamide | ||
|---|---|---|---|---|
| CAS Number | 922015-22-3 | Molecular Weight | 468.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H32N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N1-(3,4-dimethoxyphenyl)-N2-(2-(1-methylindolin-5-yl)-2-morpholinoethyl)oxalamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H32N4O5 |
|---|---|
| Molecular Weight | 468.5 |
| InChIKey | GWCPVMJCFWKKKU-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)C(=O)NCC(c2ccc3c(c2)CCN3C)N2CCOCC2)cc1OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N1-(3,4-dimethoxyphenyl)-N2-(2-(1-methylindolin-5-yl)-2-morpholinoethyl)oxalamide? |
| A: Molecular formula of N1-(3,4-dimethoxyphenyl)-N2-(2-(1-methylindolin-5-yl)-2-morpholinoethyl)oxalamide is C25H32N4O5. |
| Q: What is the Chinese name of 922015-22-3? |
| A: Chinese name of 922015-22-3 is 922015-22-3. |
| Q: What is the English name of N1-(3,4-dimethoxyphenyl)-N2-(2-(1-methylindolin-5-yl)-2-morpholinoethyl)oxalamide? |
| A: The English name of N1-(3,4-dimethoxyphenyl)-N2-(2-(1-methylindolin-5-yl)-2-morpholinoethyl)oxalamide is N1-(3,4-dimethoxyphenyl)-N2-(2-(1-methylindolin-5-yl)-2-morpholinoethyl)oxalamide. |
| Q: What is the CAS number of N1-(3,4-dimethoxyphenyl)-N2-(2-(1-methylindolin-5-yl)-2-morpholinoethyl)oxalamide? |
| A: CAS number of N1-(3,4-dimethoxyphenyl)-N2-(2-(1-methylindolin-5-yl)-2-morpholinoethyl)oxalamide is 922015-22-3. |
| Q: What is the molecular weight of N1-(3,4-dimethoxyphenyl)-N2-(2-(1-methylindolin-5-yl)-2-morpholinoethyl)oxalamide? |
| A: Molecular weight of N1-(3,4-dimethoxyphenyl)-N2-(2-(1-methylindolin-5-yl)-2-morpholinoethyl)oxalamide is 468.5. |
| Q: What is the InChIKey of N1-(3,4-dimethoxyphenyl)-N2-(2-(1-methylindolin-5-yl)-2-morpholinoethyl)oxalamide? |
| A: InChIKey of N1-(3,4-dimethoxyphenyl)-N2-(2-(1-methylindolin-5-yl)-2-morpholinoethyl)oxalamide is GWCPVMJCFWKKKU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N1-(3,4-dimethoxyphenyl)-N2-(2-(1-methylindolin-5-yl)-2-morpholinoethyl)oxalamide? |
| A: SMILES notation of N1-(3,4-dimethoxyphenyl)-N2-(2-(1-methylindolin-5-yl)-2-morpholinoethyl)oxalamide is COc1ccc(NC(=O)C(=O)NCC(c2ccc3c(c2)CCN3C)N2CCOCC2)cc1OC. |