N-(2-iodo-4,6-dimethylphenyl)-N,2-dimethylbut-2-enamide structure
|
Common Name | N-(2-iodo-4,6-dimethylphenyl)-N,2-dimethylbut-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 922170-73-8 | Molecular Weight | 343.20300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18INO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-iodo-4,6-dimethylphenyl)-N,2-dimethylbut-2-enamide |
|---|
| Molecular Formula | C14H18INO |
|---|---|
| Molecular Weight | 343.20300 |
| Exact Mass | 343.04300 |
| PSA | 20.31000 |
| LogP | 3.83700 |
| InChIKey | DEPGUCWAFNPFCC-UHFFFAOYSA-N |
| SMILES | CC=C(C)C(=O)N(C)c1c(C)cc(C)cc1I |
|
~75%
N-(2-iodo-4,6-d... CAS#:922170-73-8 |
| Literature: Lapierre, Andre J. B.; Geib, Steven J.; Curran, Dennis P. Journal of the American Chemical Society, 2007 , vol. 129, # 3 p. 494 - 495 |