tert-butyl N-[2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl]carbamate structure
|
Common Name | tert-butyl N-[2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 92235-95-5 | Molecular Weight | 245.27600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H19N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl N-[2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H19N3O4 |
|---|---|
| Molecular Weight | 245.27600 |
| Exact Mass | 245.13800 |
| PSA | 107.00000 |
| LogP | 1.25830 |
| InChIKey | BAAFNUQYKFRKQZ-UHFFFAOYSA-N |
| SMILES | CNC(=O)CNC(=O)CNC(=O)OC(C)(C)C |
|
~81%
tert-butyl N-[2... CAS#:92235-95-5 |
| Literature: Capasso, Sante; Kirby, Anthony J.; Salvadori, Severo; Sica, Filomena; Zagari, Adriana Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1995 , # 3 p. 437 - 442 |
| Boc-Gly-Gly-NH-CH3 |