Phosphoramidothioicacid, ethyl-, O,O-diphenyl ester (7CI) structure
|
Common Name | Phosphoramidothioicacid, ethyl-, O,O-diphenyl ester (7CI) | ||
|---|---|---|---|---|
| CAS Number | 92254-96-1 | Molecular Weight | 293.32100 | |
| Density | 1.226g/cm3 | Boiling Point | 377.1ºC at 760mmHg | |
| Molecular Formula | C14H16NO2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.9ºC | |
| Name | N-diphenoxyphosphinothioylethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 377.1ºC at 760mmHg |
| Molecular Formula | C14H16NO2PS |
| Molecular Weight | 293.32100 |
| Flash Point | 181.9ºC |
| Exact Mass | 293.06400 |
| PSA | 72.39000 |
| LogP | 5.01990 |
| Index of Refraction | 1.597 |
| InChIKey | BUOPVZWPFVIOER-UHFFFAOYSA-N |
| SMILES | CCNP(=S)(Oc1ccccc1)Oc1ccccc1 |
|
~%
Phosphoramidoth... CAS#:92254-96-1 |
| Literature: Klee,F.C.; Kirch,E.R. Journal of Pharmaceutical Sciences, 1962 , vol. 51, p. 423 - 427 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| O,O-Diphenyl ethylamidothiophosphate |
| Ethylamidothiophosphorsaeure-diphenylester |
| (ethylamino)diphenoxyphosphino-1-thione |