Urea,N-[(2,4-dimethylphenyl)methyl]-N'-phenyl- structure
|
Common Name | Urea,N-[(2,4-dimethylphenyl)methyl]-N'-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 92277-83-3 | Molecular Weight | 254.32700 | |
| Density | 1.132g/cm3 | Boiling Point | 398.6ºC at 760 mmHg | |
| Molecular Formula | C16H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.9ºC | |
| Name | 1-[(2,4-dimethylphenyl)methyl]-3-phenylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.132g/cm3 |
|---|---|
| Boiling Point | 398.6ºC at 760 mmHg |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.32700 |
| Flash Point | 143.9ºC |
| Exact Mass | 254.14200 |
| PSA | 41.13000 |
| LogP | 4.08900 |
| Index of Refraction | 1.613 |
| InChIKey | JBPIUKOTCREPNU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(CNC(=O)Nc2ccccc2)c(C)c1 |
|
~%
Urea,N-[(2,4-di... CAS#:92277-83-3 |
| Literature: Kozhushko, B. N.; Lomakina, A. V.; Paliichuk, Yu. A.; Shokol, V. A. Journal of Organic Chemistry USSR (English Translation), 1984 , vol. 20, p. 654 - 660 Zhurnal Organicheskoi Khimii, 1984 , vol. 20, # 4 p. 721 - 727 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| t0400-4163 |
| hms2896c09 |