Carbocisteine Diethyl Ester Hydrochloride
Modify Date: 2026-08-08 19:46:13
Carbocisteine Diethyl Ester Hydrochloride structure
|
Common Name | Carbocisteine Diethyl Ester Hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 92282-33-2 | Molecular Weight | 271.76 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H18ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Carbocisteine Diethyl Ester Hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H18ClNO4S |
|---|---|
| Molecular Weight | 271.76 |
| InChIKey | IBYFHUSVPNCBAD-FJXQXJEOSA-N |
| SMILES | CCOC(=O)CSCC(N)C(=O)OCC.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Carbocisteine Diethyl Ester Hydrochloride? |
| A: CAS number of Carbocisteine Diethyl Ester Hydrochloride is 92282-33-2. |
| Q: What is the SMILES notation of Carbocisteine Diethyl Ester Hydrochloride? |
| A: SMILES notation of Carbocisteine Diethyl Ester Hydrochloride is CCOC(=O)CSCC(N)C(=O)OCC.Cl. |
| Q: What is the Chinese name of 92282-33-2? |
| A: Chinese name of 92282-33-2 is 92282-33-2. |
| Q: What is the English name of Carbocisteine Diethyl Ester Hydrochloride? |
| A: The English name of Carbocisteine Diethyl Ester Hydrochloride is Carbocisteine Diethyl Ester Hydrochloride. |
| Q: What is the InChIKey of Carbocisteine Diethyl Ester Hydrochloride? |
| A: InChIKey of Carbocisteine Diethyl Ester Hydrochloride is IBYFHUSVPNCBAD-FJXQXJEOSA-N. |
| Q: What is the molecular formula of Carbocisteine Diethyl Ester Hydrochloride? |
| A: Molecular formula of Carbocisteine Diethyl Ester Hydrochloride is C9H18ClNO4S. |
| Q: What is the molecular weight of Carbocisteine Diethyl Ester Hydrochloride? |
| A: Molecular weight of Carbocisteine Diethyl Ester Hydrochloride is 271.76. |