4-ALLYL-5-(3-CHLOROPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL structure
|
Common Name | 4-ALLYL-5-(3-CHLOROPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL | ||
|---|---|---|---|---|
| CAS Number | 92286-36-7 | Molecular Weight | 251.73500 | |
| Density | 1.32g/cm3 | Boiling Point | 339.6ºC at 760 mmHg | |
| Molecular Formula | C11H10ClN3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.2ºC | |
| Name | 3-(3-chlorophenyl)-4-prop-2-enyl-1H-1,2,4-triazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 339.6ºC at 760 mmHg |
| Molecular Formula | C11H10ClN3S |
| Molecular Weight | 251.73500 |
| Flash Point | 159.2ºC |
| Exact Mass | 251.02800 |
| PSA | 69.51000 |
| LogP | 3.07320 |
| Index of Refraction | 1.657 |
| InChIKey | WPVJPFLNVCGFQS-UHFFFAOYSA-N |
| SMILES | C=CCn1c(-c2cccc(Cl)c2)n[nH]c1=S |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-(3-chlorophenyl)-4-(prop-2-en-1-yl)-4H-1,2,4-triazole-3-thiol |
| 4-allyl-5-(3-chlorophenyl)-4H-1,2,4-triazole-3-thiol |
| 5-(3-chlorophenyl)-4-prop-2-enyl-1,2,4-triazole-3-thiol |